Abstract: An apparatus for simultaneous logging presenting a capability to perform multipole sonic and acoustic reflection surveys for near-borehole and far field imaging.

Abstract: A fluorine-containing boric acid PVB composite comprising a condensate of a fluorine-containing alcohol, boric acid and polyvinyl butyral, wherein the fluorine-containing alcohol is represented by the general formula: Rf(A-OH)k wherein k is 1 or 2; when k is 1, Rf is a perfluoroalkyl group having 6 or less carbon atoms, a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, a polyfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, or a linear or branched, perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms, a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; when k is 2, Rf is a linear or branched, perfluoroalkylene group or polyfluoroalkylene group, containing a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; and A is an alkylene group having

Abstract: A polyfluoroalkyl allyl compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CH?CH2??[I] (n: 0 to 5, a: 1 or 2, b: 0 to 3). The polyfluoroalkyl allyl compound is produced by reacting a carboxylic acid allyl adduct represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CHICH2OCOR???[II] (n, a, and b are as defined above, and R?: a C1-C3 alkyl group) with a transition metal. This method for producing provides a polyfluoroalkyl allyl compound used as a synthetic intermediate for a fluorine-containing alkylsilane compound that can remove free iodine derived from the raw material compound, before a hydrosilylation reaction is performed, without using a metal reagent having a high environmental impact, and that has excellent handling properties.

Abstract: A carboxylic acid allyl adduct of the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CHICH2OCOR???[II] wherein n is an integer of 0 to 5, a is 1 or 2, and b is an integer of 0 to 3, and R? is a C1-C3 alkyl group.

Abstract: A fluorine-containing alkylsilane compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)b(CH2)3SiR3-dXd??[I] wherein n is an integer of 0 to 5; a is 1 or 2; b is an integer of 0 to 3; R is a C1-C3 alkoxy group, a fluorine-containing alkoxy group, or an alkenyl group; X is halogen; and d is an integer of 0 to 3. The fluorine-containing alkylsilane compound is produced by reacting, in the presence of a transition metal catalyst, a polyfluoroalkyl allyl compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CH?CH2??[II] wherein n, a, and b are as defined above, with: an alkoxysilane, or a chlorosilane, followed by a reaction with lower alcohol or metal alkenyl. The production method gives a fluorine-containing alkylsilane compound that can remove free iodine derived from the raw material compound, before a hydrosilylation reaction is performed, without using a metal reagent having a high environmental load, and that also has excellent handling properties.

Abstract: A composite material of resin—fluorine-containing boric acid composite particles comprising a resin, and a condensate of boric acid and a fluorine-containing alcohol represented by the general formula RF-A-OH (wherein RF is a perfluoroalkyl group having 6 or less carbon atoms, or a polyfluoroalkyl group, in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by a hydrogen atom or hydrogen atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms; and A is an alkylene group having 1 to 6 carbon atoms, or comprising a resin, and a condensate of boric acid, the said fluorine-containing alcohol and an alkoxysilane at a molar ratio of 1.0 or less based on the fluorine-containing alcohol. These composite materials of resin—fluorine-containing boric acid composite particles has good adhesion to inorganic substrates, and the like.

Abstract: Fluorine-containing boric acid composite capsule particles comprising a condensate of a fluorine-containing alcohol, a guest compound, and boric acid particles, wherein the fluorine-containing alcohol is represented by the general formula: RF-A-OH wherein RF is: a perfluoroalkyl group having 6 or less carbon atoms, a linear or branched perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, and containing an O, S, or N atom, or a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, wherein the perfluoroalkylene group may contain an O, S, or N atom, and one fluorine atom of the terminal perfluoroalkyl group may be replaced by —(CH2)fOH (wherein f is an integer of 1 to 3); and A is an alkyl

Abstract: A polyfluoroalkyl allyl compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CH?CH2??[I] (n:0 to 5, a:1 or 2, b:0 to 3). The polyfluoroalkyl allyl compound is produced by reacting a carboxylic acid allyl adduct represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CHICH2OCOR???[II] (n, a, and b are as defined above, and R?: a C1-C3 alkyl group) with a transition metal. This method for producing provides a polyfluoroalkyl allyl compound used as a synthetic intermediate for a fluorine-containing alkylsilane compound that can remove free iodine derived from the raw material compound, before a hydrosilylation reaction is performed, without using a metal reagent having a high environmental impact, and that has excellent handling properties.

Abstract: A fluorine-containing boric acid PVB composite comprising a condensate of a fluorine-containing alcohol, boric acid and polyvinyl butyral, wherein the fluorine-containing alcohol is represented by the general formula: Rf(A-OH)k wherein k is 1 or 2; when k is 1, Rf is a perfluoroalkyl group having 6 or less carbon atoms, a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, a polyfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, or a linear or branched, perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms, a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; when k is 2, Rf is a linear or branched, perfluoroalkylene group or polyfluoroalkylene group, containing a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; and A is an alkylene group having

Abstract: A fluorine-containing alkylsilane compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)b(CH2)3SiR3-dXd??[I] wherein n is an integer of 0 to 5; a is 1 or 2; b is an integer of 0 to 3; R is a C1-C3 alkoxy group, a fluorine-containing alkoxy group, or an alkenyl group; X is halogen; and d is an integer of 0 to 3. The fluorine-containing alkylsilane compound is produced by reacting, in the presence of a transition metal catalyst, a polyfluoroalkyl allyl compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CH?CH2??[II] wherein n, a, and b are as defined above, with: an alkoxysilane, or a chlorosilane, followed by a reaction with lower alcohol or metal alkenyl. The production method gives a fluorine-containing alkylsilane compound that can remove free iodine derived from the raw material compound, before a hydrosilylation reaction is performed, without using a metal reagent having a high environmental load, and that also has excellent handling properties.

Abstract: A polyfluoroalkyl allyl compound represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CH?CH2??[I] (n: 0 to 5, a: 1 or 2, b: 0 to 3). The polyfluoroalkyl allyl compound is produced by reacting a carboxylic acid allyl adduct represented by the general formula: CF3(CF2)n(CH2CF2)a(CF2CF2)bCH2CHICH2OCOR???[II] (n, a, and b are as defined above, and R?: a C1-C3 alkyl group) with a transition metal. This method for producing provides a polyfluoroalkyl allyl compound used as a synthetic intermediate for a fluorine-containing alkylsilane compound that can remove free iodine derived from the raw material compound, before a hydrosilylation reaction is performed, without using a metal reagent having a high environmental impact, and that has excellent handling properties.

Abstract: An example method for displaying sonic logging data associated with a formation surrounding a borehole can include acquiring sonic data at a plurality of depths using an acoustic array located in the borehole and transforming the acquired sonic data from a time-space domain to a frequency-wave number domain at a limited number of discrete frequencies. The method can also include estimating slowness values at the limited number of discrete frequencies from the transformed sonic data, interpolating the estimated slowness values to obtain a projection of one or more slowness-frequency dispersions of the acquired sonic data and displaying the projection of the slowness-frequency dispersions. The projection of the slowness-frequency dispersions can include a plurality of color bands corresponding to each of the limited number of discrete frequencies.

Abstract: Fluorine-containing boric acid composite capsule particles comprising a condensate of a fluorine-containing alcohol, a guest compound, and boric acid particles, wherein the fluorine-containing alcohol is represented by the general formula: RF-A-OH wherein RF is: a perfluoroalkyl group having 6 or less carbon atoms, a linear or branched perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, and containing an O, S, or N atom, or a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, wherein the perfluoroalkylene group may contain an O, S, or N atom, and one fluorine atom of the terminal perfluoroalkyl group may be replaced by —(CH2)f0H (wherein f is an integer of 1 to 3); and A is an alky

Abstract: The present invention provides fluorine-containing boric acid composite particles comprising a condensate of boric acid and a fluorine-containing alcohol represented by the general formula: RF-A-OH ??[I] wherein RF is a perfluoroalkyl group having 6 or less carbon atoms, or a polyfluoroalkyl group, in which some of the fluorine atoms of the perfluoroalkyl group are replaced by a hydrogen atom or atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms; and A is an alkylene group having 1 to 6 carbon atoms. The fluorine-containing boric acid composite particles may also be a condensate of boric acid, the said fluorine-containing alcohol, and an alkoxysilane at a molar ratio of 1.0 or less based on the fluorine-containing alcohol. These fluorine-containing boric acid composite particles has excellent adhesion to inorganic substrates, and the like.

Abstract: Fluorine-containing titanium oxide—nano-silica composite particles comprising a condensate of a fluorine-containing alcohol and an alkoxysilane, and titanium oxide and nano-silica particles, wherein the fluorine-containing alcohol is represented by the general formula: RF—A—OH??[I] (wherein RF is a perfluoroalkyl group having 6 or less carbon atoms, or a polyfluoroalkyl group, in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by a hydrogen atom or atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms; and A is an alkylene group having 1 to 6 carbon atoms).

Abstract: A composite material of resin—fluorine-containing boric acid composite particles comprising a resin, and a condensate of boric acid and a fluorine-containing alcohol represented by the general formula RF-A-OH (wherein RF is a perfluoroalkyl group having 6 or less carbon atoms, or a polyfluoroalkyl group, in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by a hydrogen atom or hydrogen atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms; and A is an alkylene group having 1 to 6 carbon atoms, or comprising a resin, and a condensate of boric acid, the said fluorine-containing alcohol and an alkoxysilane at a molar ratio of 1.0 or less based on the fluorine-containing alcohol. These composite materials of resin—fluorine-containing boric acid composite particles has good adhesion to inorganic substrates, and the like.

Abstract: An example method for displaying sonic logging data associated with a formation surrounding a borehole can include acquiring sonic data at a plurality of depths using an acoustic array located in the borehole and transforming the acquired sonic data from a time-space domain to a frequency-wave number domain at a limited number of discrete frequencies. The method can also include estimating slowness values at the limited number of discrete frequencies from the transformed sonic data, interpolating the estimated slowness values to obtain a projection of one or more slowness-frequency dispersions of the acquired sonic data and displaying the projection of the slowness-frequency dispersions. The projection of the slowness-frequency dispersions can include a plurality of color bands corresponding to each of the limited number of discrete frequencies.

Abstract: When forming a micromachined part by water jet guided laser machining at a machine component 20, a point for forming a micromachined part is machined while moving a laser head 7 side and machine component 20 side so as to obtain a desired shape of a micromachined part.

Abstract: A laser machining device machines a workpiece having a machining portion where a hole is machined and a non-machining portion positioned on an extension of the hole. The laser machining device includes a nozzle that jets a column of liquid towards the hole of the machining portion and a laser head that introduces a laser beam into the column of liquid jetted towards the hole. The workpiece is held by a holding member. A laser beam blocking member is disposed in the non-machining portion. The laser beam blocking member blocks the laser beam that passes through the hole. Furthermore, a discharge path that discharges the liquid reaching the hole is provided in the laser beam blocking member.

Abstract: There are provided a thermal spraying method and a thermal spraying apparatus therefore, in which a gas shroud is disposed in an HVOF thermal spraying gun barrel, the velocity of metallic particles is energized and accelerated with respect to the metallic particle to be thermally sprayed from the gun, and inert gas is supplied into the space defined inside of the shroud through a circumferential slit formed in such a manner as to shield the metallic particles from the atmosphere so as to collide with the surface of a base member, thereby forming a thermally sprayed dense film having a small oxygen content without overheating the base plate by an HVOF method.