Abstract: The invention pertains to a process for preparing compounds of formula (I-A) or (I-B) here below: by reaction of perfluoroallylfluorosulfate (FAFS) of formula (II): with at least one hypofluorite of formula (II-A) or (II-B): wherein: RF in formulae (I-A) and (II-A) is a monovalent fluorocarbon C1-C20 group, optionally comprising oxygen catenary atoms, optionally comprising functional groups comprising heteroatoms (e.g. —SO2F groups); R?F in formulae (I-B) and (II-B) is a divalent fluorocarbon C1-C6 group, preferably a group of formula wherein X1 and X2, equal to or different from each other, are independently a fluorine atom or a C1-C3 fluorocarbon group. The FAFS-hypofluorite adducts of formulae (I-A) and (I-B) can be produced with high selectivity so as to access useful intermediates which can further be reacted taking advantage of the un-modified fluorosulfate group chemistry.

Abstract: Heat transfer fluids are used in the presence of metals and/or Lewis acids of mixtures. The heat transfer fluids comprise (A) hydrofluoroethers and/or hydrofluoropolyethers, liquid under the environmental conditions (25° C., 1 atm); and (B) a compound having a fluoropolyether structure having end groups selected from the pyridine, amine, and aryl classes. The heat transfer fluids have a number average molecular weight of between 400 and 10,000.

Abstract: A process for preparing perfluoropolyethers of formula T-O—(RF)z-T???(I) wherein: T, T? are end groups, z=0 or 1; RF is a perfluoro(poly)oxyalkylene chain containing one or more fluorooxyalkylene repeating units selected from the group consisting of (CF2O), —(CF(CF3)O)—, —(CF2CF2O)—, —(CF2CF(CF3)O)—, —(CF(CF3)CF2O)—, —(CF2CF2CF2O)—, —(CF2CF2CF2CF2O)—, and —(CF2)j—CFZ—O— wherein j is an integer from 0 to 3, and Z is a fluorooxyalkylene chain comprising from 1 to 20 repeating units selected from the above reported fluorooxyalkylene units; comprising the reduction of peroxidic perfluoropolyethers comprising one or more of the above defined repeating units by using gaseous hydrogen in the presence of a catalyst comprising one or more metals of the VIII group supported on graphitic materials.

Abstract: Fluorinated lubricants of formula: T-O[A-B]z-[A-B?]z?-A-T? (I) wherein: A=—(X)a—O-A?-(X?)b wherein A? is a perfluoropolyether chain comprising units (CF2O), (CF2CF2O), (CF2CF2CF2O), (CF2CF2CF2CF2O); X, X??—CF2—, —CF2CF2—; a, b=0 or 1; B derives from olefins, of which at least one homopolymerizable by radical route, of formula: —[(CR1R2—CR3R4)j(CR5R6—CR7R8)j?]— (Ia) wherein j=1-5, j?=0-4 and 2<(j+j?)<5; R1-R8=halogen, H, C1-C6 (per)haloalkyl, C1-C6 alkyl, C1-C6 oxy(per)-fluoroalkyl; z?2; z? is 0 or an integer; z, z? are such that the number average molecular weight of the polymer of formula (I) is in the range 500-500,000; B?=(Ia) but at least one of R1-R8 has a meaning different than that in B and 2?(j+j?)<5; T, T?=C1-C3 perfluoroalkyl, C1-C6 alkyl and compositions thereof.

Abstract: A process for preparing peroxidic perfluoropolyethers having a perioxidic content (PO) lower than or equal to 1.2 of formula A-CF2O(CF2CF2O)m(CF2O)n—(CF2CF2OO)ml(CF2OO)n1CF2—B??(I) Wherein A, B equal to or different from each other are —C1, —F, —F2CC1, —COF, —OCOF, —CF3, m, m1, n, n1 are integers such that the (m+m1)/(n+n1) ratio is between 0.6 and 1.3 and the m/n ration is between 0.5 and 1.2; the number average molecular weight is in the range 35,000-45,000, by tetrafluoroethylene (TFE) photooxidation in the presence of UV light, at a temperature from ?80° C. to ?40° C., in the presence of a mixture of solvents formed of HFC-227 (hepta-fluoropropane) and a solvent selected between HFC-125 (pentafluoroethane) and FC-218 (perfluoropropane).

Abstract: Polymers of formula Q-O-[A-B]z-[A-B?]z-A-Q???(I) wherein: A=-(X)a—O-A?-(X?)b— with A?=perfluoropolyether chain and X, X?=—CF2—, —CF2CF2—; a, b=0.1 with the proviso that a=1 if A is linked to Q-O—; b=0 when A is linked to Q?; B derives from homopolymerizable olefins by radical route, of formula: —[(CR1R2—CR3R4)j(CR5R6—CR7R8)j?]—??(Ia) wherein j is an integer from 1 to 30, j? is an integer from 0 to 29 with the proviso that (j+j?) is higher than 2 and lower than 30; R1-R8 are halogen; H; C1-C6 (per)haloalkyl; C1-C6 alkyl; or C1-C6 oxy(per)fluoroalkyl; B?=B but at least one among R1-R8 has a meaning different from that in B; z, z? are such that the number average molecular weight of the polymer of formula (I) is between 500 and 150,000; Q, Q?=C1-C3 (per)fluoroalkyl or functional end group —(CFW)-Dq-Tk; W=F, CF3; k and q are integers, k ranges from 1 to 4, q is an integer and is equal to 0 or 1; with the proviso that at least one of Q, Q? is functional end group.

Abstract: Peroxidic perfluoropolyethers having formula: X1—O(CF2O)n1(CF2CF2O)m1(CF2(CF2)zCF2O)p1(O)h—X2??(I) wherein: X1 and X2, equal to or different from each other, are chain end groups selected among —CF2COF, —COF, —SO2F; n1, m1, p1 and h are integers such that the number average molecular weight is in the range 700-100,000; z=1 or 2; with the proviso that: the m1/n1 ratio is between 0.2 and 10; the p1/(n1+m1) ratio is lower than 0.05; the h/(n1+m1+p1) ratio is such that the PO content, defined as grams of active oxygen/100 g of compound, is in the range 0.8-4.5, preferably 1.4-3.8; the perfluorooxyalkylene units being statistically distributed along the polymeric chain.

Abstract: A process for preparing monocarboxylic perfluoropolyethers of formula: A-O-(RF)z-(CFY)t-C(O)OX (I) wherein: X is H, C1-C10 alkyl, or an aryl group; Y=F, CF3; t=1, 2 or 3; A is a C1-C4 perfluoroalkyl end group; z=0 or 1; RF is a perfluorooxyalkylene chain; having a number average molecular weight in the range 180-8,000; comprising the following steps: a) one or more distillations of perfluoropolyethers (PFPE) of formula T-O-(RF)z-T? (II) wherein: z and RF are as above defined; T, T?, equal to or different from each other, are selected from acyl fluoride or carbonyl-containing functional end groups and non functional end groups to obtain one PFPE fraction of formula (II) wherein the difference between the minimum and the maximum molecular weight of the components is lower than or equal to 600; b) partial fluorination of the fraction obtained in a); c) esterification c1) and/or hydrolysis c2) of the mixture obtained in b); d) distillation of the product obtained in c2) or in c1).

Abstract: Processes for the preparation of perfluoropolyethers having structural formula R1O—(CF2O)n—(CF2CF2O)mR2??(I) wherein: R1 is —CH3 or —C2H5; R2 is equal to R1 or —CF2H n is 0 or an integer from 1 to 100; m is an integer from 1 to 100 or, when R2 is —CF2H, m can also be 0; the oxyfluoroalkylene units —(CF2CF2O)— and —(CF2O)— are statistically distributed along the polymer chain.

Abstract: Use as heat transfer fluids in the presence of metals and/or Lewis acids of mixtures comprising: (A) hydrofluoroethers and/or hydrofluoropolyethers, liquid under the environmental conditions (25° C., 1 atm); (B) a compound having a fluoropolyether structure having end groups selected from the pyridine, amine, aryl classes; and having a number average molecular weight comprised between 400 and 10,000.

Abstract: Peroxidic perfluoropolyethers having formula: X1—O(CF2O)n1(CF2CF2O)m1(CF2(CF2)zCF2O)p1(O)h—X2 ??(I) wherein: X1 and X2, equal to or different from each other, are chain end groups selected among —CF2COF, —COF, —SO2F; n1, m1, p1 and h are integers such that the number average molecular weight is in the range 700-100,000; z=1 or 2; with the proviso that: the m1/n1 ratio is between 0.2 and 10; the p1/(n1+m1) ratio is lower than 0.05; the h/(n1+m1+p1) ratio is such that the PO content, defined as grams of active oxygen/100 g of compound, is in the range 0.8-4.5, preferably 1.4-3.8; the perfluorooxyalkylene units being statistically distributed along the polymeric chain.

Abstract: Peroxidic perfluoropolyethers having formula: X1—O(CF2O)n1(CF2CF2O)m1(CF2(CF2)zCF2O)p1(O)h—X2??(I) wherein: X1 and X2, equal to or different from each other, are chain end groups selected among —CF2COF, —COF, —SO2F; n1, m1, p1 and h are integers such that the number average molecular weight is in the range 700-100,000; z=1 or 2; with the proviso that: the m1/n1 ratio is between 0.2 and 10; the p1/(n1+m1) ratio is lower than 0.05; the h/(n1+m1+p1) ratio is such that the PO content, defined as grams of active oxygen/100 g of compound, is in the range 0.8-4.5, preferably 1.4-3.8; the perfluorooxyalkylene units being statistically distributed along the polymeric chain.

Abstract: Peroxidic perfluoropolyethers having formula: X1—O(CF2O)n1(CF2CF2O)m1(CF2(CF2)zCF2O)p1(O)h—X2 ??(I) wherein: X1 and X2, equal to or different from each other, are chain end groups selected between —CF2COF and —COF; n1, m1, p1 and h are integers such that the number average molecular weight is in the range 700-100,000; z=1 or 2; with the proviso that: the m1/n1 ratio is between 0.2 and 10; the p1/(n1+m1) ratio is lower than 0.05; the h/(n1+m1+p1) ratio is such that the PO content, defined as grams of active oxygen/100 g of compound, is in the range 0.8-4.5, preferably 1.4-3.8; the perfluorooxyalkylene units being statistically distributed along the polymeric chain.

Abstract: A process for preparing peroxidic perfluoropolyethers having a peroxidic content (PO) higher than 1.2 of formula A-CF2O(CF2CF2O)m(CF2O)n—(CF2CF2OO)ml(CF2OO)nlCF2—B??(I) wherein A, B, equal to or different from each other are Cl—, F—, ClCF2—, COF—, —OCOF, —CF3, m, ml, n, nl are integers such that the (m+ml)/(n+nl) ratio is between 0.9 and 5 and the m/n ratio is between 0.8 and 3, the number average molecular weight is in the range 35,000-45,000, by tetrafluoroethylene (TFE) photooxidation in the presence of UV light, at a temperature from ?80° C. to ?40° C., in the presence of a mixture of solvents formed of HFC-227 (heptafluoropropane) and a solvent selected from HFC-125 (pentafluoroethane) and FC-218 (perfluoropropane).

Abstract: Perfluoropolyethers obtained by oxidation of perfluorodioxoles of formula (I) wherein Rf=—F, —(O)yCnF2n+1 with y=0, 1 and n=1, 2, 3, 4, 5, and with W=—F, —CnF2n+1, optionally in the presence of tetrafluoroethylene and/or hexafluoropropene, and subsequent reduction of the obtained peroxidic perfluoropolyethers.

Abstract: Linear perfluoropolyethers of formula: T-O(CF2O)n(CF2CF2O)m(CF2CF2CF2O)r(CF2CF2CF2CF2O)s-T1??(I) wherein n, m, r, s are integers such that the polymer number average molecular weight is comprised between 700 and 100,000 and the n/(n+m+r+s) ratio ranges from 0.05 to 0.40, and respective preparation process by addition of a peroxidic perfluoropolyether of formula (III): T4-O(CF2O)n?(CF2CF2O)m?(O)h-T5??(III) having a PO from 1.8 to 4, to a perfluoropolyether oil preheated at a temperature comprised between 150° C. and 250° C. and subsequent exhaustive fluorination of the obtained compound.

Abstract: A process to obtain perfluoropolyethers comprising: a) synthesis of peroxidic perfluoropolyethers by one of the following reactions: al) TFE photooxidation, in solvents selected between perfluorocarbons and (mono)hydrofluorocarbons, of general formula: CyF(2y+2?X)Hx ??(II) ?wherein y is an integer from 2 to 4; x is an integer equal to 0 or 1; in the present of fluorine diluted with an inert gas; or a2) TFE oxidation using as radical initiator fluorine or hypofluorites of formula RfOF??(III) ?(Rf perfluoroalkyl radical from 1 to 3 carbon atoms), operating from ?40° C. to ?100° C. at a pressure comprised between 0 and 12 bar; b) thermal treatment of the product obtained in a) at a temperature from 1500° C. to 250° C.; c) treatment with elemental fluorine of the polymer obtained in step b) at temperatures from 100° C. to 250° C., or by treatment with fluorine in the presence of UV radiations, operating at temperatures from ?50° C. to 120° C.

Abstract: Linear perfluoropolyethers of formula: T-O(CF2O)n(CF2CF2O)m(CF2CF2CF2O)r(CF2CF2CF2CF2O)s-T1??(I) wherein n, m, r, s are integers such that the polymer number average molecular weight is comprised between 700 and 100,000 and the n/(n+m+r+s) ratio ranges from 0.05 to 0.40, and respective preparation process by addition of a peroxidic perfluoropolyether of formula (III): T4—O(CF2O)n?(CF2CF2O)m?(O)h-T5??(III) having a PO from 1.8 to 4, to a perfluoropolyether oil preheated at a temperature comprised between 150° C. and 250° C. and subsequent exhaustive fluorination of the obtained compound.

Abstract: Fluorinated lubricants comprising “pour point depressant” additives of structure: X1—O(CF2O)n(CF2CF2O)m(CF2CF2CF2O)p(CF2CF2CF2CF2O)q—X2??(I) wherein X1, X2, have formula —(CF2)zCF3 wherein z is an integer from 0 to 3; n is an integer between 1 and 200; m is an integer between 0 and 200; p, q are integers between 0 and 10; (p+q)/(p+q+m+n)?0.05; m/n?0.7; the number average molecular weight of (I) is between 1,000 and 10,000.

Abstract: Perfluoropolyethers having structural formula R1O—(CF2O)n—(CF2CF2O)mR2??(I) wherein: R1 is —CH3 or —C2H5; R2 is equal to R1 or —CF2H n is 0 or an integer from 1 to 100; m is an integer from 1 to 100 or, when R2 is —CF2H, m can also be 0; the oxyfluoroalkylene units —(CF2CF2O)— and —(CF2O)— are statistically distributed along the polymer chain.