Abstract: A fluorine-containing pyrimidine compound represented by formula (1), (2) or (3) is provided: wherein in formulae (1) to (3), R represents a hydrocarbon group having 1 to 12 carbon atoms, X and Y each independently represent a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1, a nitro group, a boronic acid group, —OA1, —SOmA1, —NA1A2, —COOA1 or —CONA1A2, Z represents CW or N, W represents a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1, a nitro group, a boronic acid group, —OA1, —SOmA1, —NA1A2, —COOA1 or —CONA1A2, n is an integer of 1 to 10 and m is an integer of 0 to 3, and A1 and A2 each independently represent a hydrogen atom or a hydrocarbon group having 1 to 10 carbon atoms.

Abstract: A fluorine-containing pyrazole compound is represented by the following general formula (1): wherein in formula (1) above, R represents a hydrocarbon group having 1 to 12 carbon atoms, and a ring Z represents an aromatic heterocyclic ring containing at least one heteroatom selected from the group consisting of a nitrogen atom, an oxygen atom, and a sulfur atom.

Abstract: Provided are: an ionic liquid including the fluorine-containing phosphate ester anions represented by formula (1); and a lubricating oil composition including said ionic liquid. (In the formula, Rf represents a C1-14 perfluoroalkyl group. R1 represents a C1-8 alkyl group.

Abstract: A fluorine-containing fused ring pyrimidine compound is provided represented by the following formula (1): wherein in the above formula (1): R represents a hydrocarbon group having 1 to 12 carbon atoms; X, Y and Z each independently represent a carbon atom or a nitrogen atom; X and Y optionally form ring Q1 with a carbon atom or a nitrogen atom bonded to each other; Y and Z optionally form ring Q2 with a carbon atom or a nitrogen atom bonded to each other; and ring Q1 and ring Q2 each represent a monocyclic ring or fused ring having 6,10 or 14 ? electrons constituting the ring and optionally comprise a heteroatom.

Abstract: Provided are: an ionic liquid including the fluorine-containing phosphate ester anions represented by formula (1); and a lubricating oil composition including said ionic liquid. (In the formula, Rf represents a C1-14 perfluoroalkyl group. R1 represents a C1-8 alkyl group.

Abstract: A fluorine-containing pyrimidine compound represented by the following formula (1) is provided: wherein R represents a hydrocarbon group having 1 to 12 carbon atoms, B1 represents a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1, a nitro group, a boronic acid group, —OA1, —SOmA1, —NA1A2, —COOA1 or —CONA1A2, W, X, Y and Z each independently represent CV or N, provided that at least one of W, X, Y and Z is N, V represents a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1, a nitro group, a boronic acid group, —OA1, —SOmA1, —NA1A2, —COOA1 or —CONA1A2, n is an integer of 1 to 10, m is an integer of 0 to 3, and A1 and A2 each independently represent a hydrogen atom or a hydrocarbon group having 1 to 10 carbon atoms.

Abstract: A fluorine-containing pyrimidine compound represented by the following formula (1): wherein in the general formula (1) above, R represents a hydrocarbon group having 1 to 12 carbon atoms, and a ring Z represents a fused heterocyclic ring containing a heteroatom.

Abstract: A fluorine-containing pyrimidine compound is provided represented by formula (1): wherein in the above formula (1), R represents a hydrocarbon group having 1 to 12 carbon atoms, B1 and B2 each independently represent a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1 where n is an integer of 1 to 10, a nitro group, a boronic acid group, —OA1, —SOmA1 where m is an integer of 0 to 3, —NA1A2, —COOA1 or —CONA1A2, W, X, Y and Z each independently represent CV or N, V represents a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1 where n is an integer of 1 to 10, a nitro group, a boronic acid group, —OA1, —SOmA1 where m is an integer of 0 to 3, —NA1A2, —COOA1 or —CONA1A2, and A1 and A2 each independently represent a hydrogen atom or a hydrocarbon group having 1 to 10 carbon atoms.

Abstract: A fluorine-containing pyrimidine compound is provided represented by general formula (1), (2), (3), (4), (5), or (6) below. wherein, in the general formulae (1) to (6) above, R represents a hydrocarbon group having 1 to 12 carbon atoms; and X and Y each independently represent a hydrogen atom, a halogen atom, a hydrocarbon group having 1 to 10 carbon atoms, —CnF2n+1 (n is an integer of 1 to 10), a nitro group, a boronate group, —OA1, —SOmA1 (m is an integer of 0 to 3), —NA1A2, —COOA1, or —CONA1A2, and A1 and A2 each independently represent a hydrogen atom or a hydrocarbon group having 1 to 10 carbon atoms.

Abstract: Provided are a fluorine-containing monomer capable of being dissolved in a general organic solvent such as a hydrocarbon solvent and simultaneously having excellent water and oil repellency, and a method for producing the fluorine-containing monomer. The fluorine-containing monomer is a carboxylic acid ester compound having a polymerizable functional group and a fluorine atom group, represented by the following general formula: CaF2a+1O—(CbF2bO)c—C2F4COOR. The method is a process for producing the carboxylic acid ester compound, characterized by that any one of an isocyanulate derivative, a phthalic acid derivative and a cycloalkane dialcohol modified (meth)acrylate each having a terminal hydroxyl group is made to react with a perfluoropolyether carboxylic acid halide.

Abstract: A fluorine-containing ether monocarboxylic acid aminoalkyl ester represented by the general formula: CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COO(CH2)bNR1R2 (wherein R1 is a hydrogen atom, an alkyl group having 1 to 12 carbon atoms, an aryl group, or an aralkyl group, preferably an alkyl group having 1 to 6 carbon atoms or an aryl group; R2 is an alkyl group having 1 to 12 carbon atoms, an aryl group, or an aralkyl group, preferably an alkyl group having 1 to 6 carbon atoms or an aryl group; n is an integer of 1 to 3; a is an integer of 2 to 20, preferably an integer of 4 to 10; and b is an integer of 1 to 12, preferably an integer of 1 to 3). Such a fluorine-containing ether monocarboxylic acid ester having an amino group at the end of the ester group is produced by reacting a perfluoroether carboxylic acid fluoride compound CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COF and a hydroxyalkyl amine compound HO(CH2)bNR1R2 in the presence of an alkali metal fluoride.

Abstract: A fluorine-containing ether monocarboxylic acid aminoalkyl ester represented by the general formula: CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COO(CH2)bNR1R2 (wherein R1 is a hydrogen atom, an alkyl group having 1 to 12 carbon atoms, an aryl group, or an aralkyl group, preferably an alkyl group having 1to 6 carbon atoms or an aryl group; R2 is an alkyl group having 1 to 12 carbon atoms, an aryl group, or an aralkyl group, preferably an alkyl group having 1to 6 carbon atoms or an aryl group; n is an integer of 1 to 3; a is an integer of 2 to 20, preferably an integer of 4 to 10; and b is an integer of 1 to 12, preferably an integer of 1 to 3). Such a fluorine-containing ether monocarboxylic acid ester having an amino group at the end of the ester group is produced by reacting a perfluoroether carboxylic acid fluoride compound CnF2n+1O[CF(CF3)CF2O]1CF(CF3)COF and a hydroxyalkyl amine compound HO(CH2)bNR1R2 in the presence of an alkali metal fluoride.

Abstract: A perfluorovinyloxy polyether carboxylic acid alkali metal salt represented by the general formula is provided: CF2?CF[OCF2CF(CF3)]bO(CF2)aO[CF(CF3)CF2O]cCF(CF3)COOM??[I], wherein M is alkali metal, preferably sodium or potassium, a is an integer of 1 to 6, preferably 2, and b+c is an integer of 0 to 6, preferably 0 or 1. This perfluorovinyloxy polyether carboxylic acid alkali metal salt is produced by subjecting a perfluorovinyloxy polyether carboxylic acid alkyl ester represented by the general formula: CF2?CF[OCF2CF(CF3)]bO(CF2)aO[CF(CF3)CF2O]cCF(CF3)COOR??[II], wherein R is an alkyl group having 1 to 12 carbon atoms, a is an integer of 1 to 6, and b+c is an integer of 0 to 6; to hydrolysis or solvolysis in the presence of an alkali metal hydroxide.

Abstract: A bis(perfluoroether carboxylic acid alkyl)amino ester represented by the general formula: {CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COO(CH2)b}2NR, wherein R is a hydrogen atom, an alkyl group having 1 to 12 carbon atoms, an aryl group, or an aralkyl group; preferably an alkyl group having 1 to 6 carbon atoms or an aryl group; n is an integer of 1 to 3; a is an integer of 0 to 20, preferably an integer of 1 to 6; and b is an integer of 1 to 12, preferably an integer of 1 to 4. The bis(perfluoroether carboxylic acid alkyl)amino ester having an amino group at the end of the ester group is produced by reacting a perfluoroether carboxylic acid fluoride compound of the formula: CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COF and a bis(hydroxyalkyl)amine compound of the formula: HO(CH2)bNR(CH2)bOH at a molar ratio of 2:1 in the presence of an alkali metal fluoride.

Abstract: A perfluorovinyloxy polyether carboxylic acid alkali metal salt represented by the general formula is provided: CF2?CF[OCF2CF(CF3)]bO(CF2)aO[CF(CF3)CF2O]cCF(CF3)COOM??[I], wherein M is alkali metal, preferably sodium or potassium, a is an integer of 1 to 6, preferably 2, and b+c is an integer of 0 to 6, preferably 0 or 1. This perfluorovinyloxy polyether carboxylic acid alkali metal salt is produced by subjecting a perfluorovinyloxy polyether carboxylic acid alkyl ester represented by the general formula: CF2?CF[OCF2CF(CF3)]bO(CF2)aO[CF(CF3)CF2O]cCF(CF3)COOR??[II], wherein R is an alkyl group having 1 to 12 carbon atoms, a is an integer of 1 to 6, and b+c is an integer of 0 to 6; to hydrolysis or solvolysis in the presence of an alkali metal hydroxide.

Abstract: A bis(perfluoroether carboxylic acid alkyl)amino ester represented by the general formula: {CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COO(CH2)b}2NR, wherein R is a hydrogen atom, an alkyl group having 1 to 12 carbon atoms, an aryl group, or an aralkyl group; preferably an alkyl group having 1 to 6 carbon atoms or an aryl group; n is an integer of 1 to 3; a is an integer of 0 to 20, preferably an integer of 1 to 6; and b is an integer of 1 to 12, preferably an integer of 1 to 4. The bis(perfluoroether carboxylic acid alkyl)amino ester having an amino group at the end of the ester group is produced by reacting a perfluoroether carboxylic acid fluoride compound of the formula: CnF2n+1O[CF(CF3)CF2O]aCF(CF3)COF and a bis(hydroxyalkyl)amine compound of the formula: HO(CH2)bNR(CH2)bOH at a molar ratio of 2:1 in the presence of an alkali metal fluoride.

Abstract: A fluorine-containing vinyl ether compound of the formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOCH?CH2 is produced by subjecting a fluorine-containing alcohol of the formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOH wherein n is an integer of 1 to 6, a is an integer of 1 to 4, b is an integer of 1 to 3, and c is an integer of 1 to 3, and 2-haloethyl vinyl ether of the formula: XCH2CH2OCH?CH2 to XCH2CH2OH-elimination reaction in the presence of a palladium-based catalyst and an aliphatic amine. The fluorine-containing vinyl ether compound contain a perfluoroalkyl group having 6 or less carbon atoms, which is said to have low bioaccumulation potential.

Abstract: A fluorine-containing vinyl ether compound of the formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOCH?CH2 is produced by subjecting a fluorine-containing alcohol of the formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOH wherein n is an integer of 1 to 6, a is an integer of 1 to 4, b is an integer of 1 to 3, and c is an integer of 1 to 3, and 2-haloethyl vinyl ether of the formula: XCH2CH2OCH?CH2 to XCH2CH2OH-elimination reaction in the presence of a palladium-based catalyst and an aliphatic amine. The fluorine-containing vinyl ether compound contain a perfluoroalkyl group having 6 or less carbon atoms, which is said to have low bioaccumulation potential.

Abstract: A fluorine-containing polyether carboxylic acid amide represented by the general formula: CnF2n+1O(C3F6O)mRfCONHAr, wherein Rf is a fluorocarbon group having 1 to 2 carbon atoms, Ar is a nitrogen-containing heterocyclic group, n is an integer of 1 to 3, and m is an integer of 10 to 30, is produced by reacting a fluorine-containing polyether carboxylic acid fluoride represented by the general formula: CnF2n+1(C3F6O)mRfCOF, wherein Rf, n, and m are as defined above, with a nitrogen-containing heterocyclic amine compound represented by the general formula: ArNH2, wherein Ar is as defined above; wherein the reaction is carried out while a reaction temperature is first increased to 80 to 100° C., and then increased at a temperature increase rate that produces a temperature difference of 3 to 5° C. after 48 hours.

Abstract: Disclosed is a diurethane compound R2(SO2)m(CH2)nOCONH—R1—NHCOO(CH2)n(SO2)mR2 produced by a method allowing a diamine compound H2NR1NH2 to react with a chloroformate compound ClCOO(CH2)n(SO2)mR2 or a method allowing a diisocyanate compound OCNR1NCO to react with a hydroxyl-containing compound R2(SO2)m(CH2)nOH. The diurethane compound is compounded with multivalent amine crosslinkable group-containing acrylic rubber together with a basic vulcanization accelerator to form an acrylic rubber composition. The acrylic rubber composition including the diurethane compound as a vulcanizing agent decreases a delay in the vulcanization rate due to prevention of scorching and also allows a vulcanized article to satisfy the compression set characteristics.