Abstract: A paper feeder includes a processor configured to, in a case of lowering a paper feed tray on which paper is placed in an accommodation section that accommodates paper and replenishing paper, the paper feed tray being controlled to be raised/lowered in a case of replenishing paper, control a lowering amount of the paper feed tray according to a number of sheets of paper to be replenished.

Abstract: The present invention relates to a compound of general formula (I) (wherein R1, R2, and R3 are each independently a hydrogen atom or a lower alkyl and X is an alkali metal cation, ammonium cation, or quaternary ammonium cation). This compound is highly soluble in water, and solutions thereof need not be neutralized when administered to the living body. The compound is useful as a medicine, etc.

Abstract: A development support apparatus includes: an estimation unit that estimates behavior of an energy storage device by using an equivalent circuit model reflecting a state of charge (SOC)-operating voltage characteristic in a high change-amount region where an amount of change in an operating voltage with respect to an amount of change in the SOC is relatively higher than in other regions among SOC-operating voltage characteristics during constant current charge and discharge of the energy storage device; and an output unit that outputs a result of an estimation by the estimation unit.

Abstract: The present invention provides a method for efficiently leaching copper from copper sulfide ore by separating and recovering iodine, and iron(III) ions to be used are regenerated by a heap of stacked ore in the method for leaching copper from copper sulfide using a sulfuric acid solution containing iodide ions and iron(III) ions as a leaching solution.

Abstract: A fluorine-containing boric acid PVB composite comprising a condensate of a fluorine-containing alcohol, boric acid and polyvinyl butyral, wherein the fluorine-containing alcohol is represented by the general formula: Rf(A-OH)k wherein k is 1 or 2; when k is 1, Rf is a perfluoroalkyl group having 6 or less carbon atoms, a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, a polyfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, or a linear or branched, perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms, a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; when k is 2, Rf is a linear or branched, perfluoroalkylene group or polyfluoroalkylene group, containing a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; and A is an alkylene group having

Abstract: An oil-absorbing mat for disposing on a floor and absorbing an oil, comprising: an oil absorber for absorbing the oil, the oil absorber being provided on the upper surface of the oil-absorbing mat; and a permeation preventing layer for preventing the permeation of the oil, the permeation preventing layer being provided on the floor surface of the oil-absorbing mat; wherein the oil absorber has a smoothness of 0.8 s or more as measured on the basis of JIS P 8155; and wherein the oil absorber has an air resistance (Oken Type) of 28 s or less as measured on the basis of JIS P 8117.

Abstract: Provided is a fluorine-containing diblock copolymer having good water and oil repellency by using, as a raw material, a fluorine-containing (meth)acrylic ester having low bioaccumulation potential. The fluorine-containing diblock copolymer is produced by: process (A) a process for producing a fluorine-containing diblock copolymer by polymerizing a fluorine-containing (meth)acrylic ester represented by the following formula (1) in the presence of a trithiocarbonic ester compound and a radical polymerization initiator and then polymerizing a non-fluorine vinyl-based monomer, or process (B) a process for producing a fluorine-containing diblock copolymer by polymerizing a non-fluorine vinyl-based monomer in the presence of a trithiocarbonic ester compound and a radical polymerization initiator and then polymerizing a fluorine-containing (meth)acrylic ester represented by the following formula (1).

Abstract: A composite material of resin—fluorine-containing boric acid composite particles comprising a resin, and a condensate of boric acid and a fluorine-containing alcohol represented by the general formula RF-A-OH (wherein RF is a perfluoroalkyl group having 6 or less carbon atoms, or a polyfluoroalkyl group, in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by a hydrogen atom or hydrogen atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms; and A is an alkylene group having 1 to 6 carbon atoms, or comprising a resin, and a condensate of boric acid, the said fluorine-containing alcohol and an alkoxysilane at a molar ratio of 1.0 or less based on the fluorine-containing alcohol. These composite materials of resin—fluorine-containing boric acid composite particles has good adhesion to inorganic substrates, and the like.

Abstract: Fluorine-containing boric acid composite capsule particles comprising a condensate of a fluorine-containing alcohol, a guest compound, and boric acid particles, wherein the fluorine-containing alcohol is represented by the general formula: RF-A-OH wherein RF is: a perfluoroalkyl group having 6 or less carbon atoms, a linear or branched perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, and containing an O, S, or N atom, or a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, wherein the perfluoroalkylene group may contain an O, S, or N atom, and one fluorine atom of the terminal perfluoroalkyl group may be replaced by —(CH2)fOH (wherein f is an integer of 1 to 3); and A is an alkyl

Abstract: The present invention provides a method for efficiently leaching copper from copper sulfide ore by separating and recovering iodine, and iron(III) ions to be used are regenerated by a heap of stacked ore in the method for leaching copper from copper sulfide using a sulfuric acid solution containing iodide ions and iron(III) ions as a leaching solution.

Abstract: Disclosed is an emulsion formed using, as an emulsifier, 0.01 to 30 parts by weight of a perfluoroalkylethyl phosphonic acid salt represented by the general formula: CnF2n+1CH2CH2P(O)(OM1)(OM2) [III] (M1: a hydrogen atom, ammonium salt, or organic amine salt, M2: an ammonium salt or organic amine salt, n: 1 to 6), based on 100 parts by weight of a perfluoropolyether oil represented by the general formula: RfO(C3F6O)p(C2F4O), (CF2O), Rf? [I] (Rf and Rf?: C1-C5 perfluoroalkyl groups, p+q+r: 2 to 200) or the general formula: F(CF2CF2CF2O)nCF2CF3 [II](n: 2 to 100), or a perfluorocarbon compound. In spite of using, as an emulsifier, a compound having a perfluoroalkyl group containing 6 or less carbon atoms, which is said to have low bioaccumulation potential, the emulsion exhibits excellent emulsification stability, and therefore can be effectively used as a surface-treating agent, such as a mold-releasing agent.

Abstract: A fluorine-containing boric acid PVB composite comprising a condensate of a fluorine-containing alcohol, boric acid and polyvinyl butyral, wherein the fluorine-containing alcohol is represented by the general formula: Rf(A-OH)k wherein k is 1 or 2; when k is 1, Rf is a perfluoroalkyl group having 6 or less carbon atoms, a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, a polyfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, or a linear or branched, perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms, a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; when k is 2, Rf is a linear or branched, perfluoroalkylene group or polyfluoroalkylene group, containing a perfluoroalkylene group having 6 or less carbon atoms and ether bonds; and A is an alkylene group having

Abstract: Disclosed is a fluorine-containing oligomer comprising a copolymer of a fluoroalkyl alcohol (meth)acrylic acid derivative represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOCOCR?CH2??[I] wherein R is a hydrogen atom or a methyl group, n is an integer of 1 to 6, a is an integer of 1 to 4; b is an integer of 0 to 3; and c is an integer of 1 to 3; and a (meth)acrylic acid derivative represented by the general formula: (CH2?CRCO)mR???[II] wherein R is a hydrogen atom or a methyl group, m is 1, 2, or 3; and when m is 1, R? is OH group, NH2 group that is unsubstituted or mono- or di-substituted with an alkyl group having 1 to 6 carbon atoms, or a monovalent group derived from an alkylene glycol or polyalkylene glycol group containing an alkylene group having 2 or 3 carbon atoms; when m is 2 or 3, R? is a divalent or trivalent organic group derived from a diol or triol. The copolymerization reaction is performed using a hydrocarbon-based peroxide or azo compound polymerization initiator.

Abstract: A transmission device includes: a communication unit that communicates with a plurality of reception devices; a transmission data setting unit that compares the number of the reception devices as transmission targets of transmission data representing content and a predetermined threshold value and sets the transmission data to be transmitted to the reception devices to each reception device based on a result of the comparison such that a transmission rate for transmission that represents an amount of data transmission necessary to transmit the transmission data to the reception devices does not exceed a reference transmission rate representing an amount of data transmission at which data can be transmitted in the communication, and the transmission data having relatively high reproduction quality is transmitted to the reception devices as the transmission targets; and a transmission processing unit that concurrently transmits the transmission data set by the transmission data setting unit to the corresponding

Abstract: Disclosed is a fluorine-containing oligomer comprising a copolymer of a fluoroalkyl alcohol (meth)acrylic acid derivative represented by the general formula: CnF2n+1(CH2CF2)a(CF2CF2)b(CH2CH2)cOCOCR?CH2??[I] wherein R is a hydrogen atom or a methyl group, n is an integer of 1 to 6, a is an integer of 1 to 4; b is an integer of 0 to 3; and c is an integer of 1 to 3; and a (meth)acrylic acid derivative represented by the general formula: (CH2?CRCO)mR???[II] wherein R is a hydrogen atom or a methyl group, m is 1, 2, or 3; and when m is 1, R? is OH group, NH2 group that is unsubstituted or mono- or di-substituted with an alkyl group having 1 to 6 carbon atoms, or a monovalent group derived from an alkylene glycol or polyalkylene glycol group containing an alkylene group having 2 or 3 carbon atoms; when m is 2 or 3, R? is a divalent or trivalent organic group derived from a diol or triol. The copolymerization reaction is performed using a hydrocarbon-based peroxide or azo compound polymerization initiator.

Abstract: Provided is a lead-acid battery including a negative electrode plate and a positive electrode plate. The negative electrode plate includes a negative electrode material containing graphite or carbon fiber, and the positive electrode plate includes a positive electrode material containing antimony.

Abstract: Disclosed is a fluorine-containing oligomer comprising a copolymer of a fluoroalkyl alcohol (meth)acrylic acid derivative of the formula: CnF2n+1(CH2)dOCOCR?CH2 [I], wherein R is a hydrogen atom or a methyl group, n is an integer of 1 to 10, and d is an integer of 1 to 6; and a (meth)acrylic acid derivative of the formula: (CH2?CRCO)mR? [II], wherein R is a hydrogen atom or a methyl group, m is 1, 2, or 3; and when m is 1, R? is —OH group, NH2 group that is unsubstituted or mono- or di-substituted with an alkyl group having 1 to 6 carbon atoms, or a monovalent group derived from an alkylene glycol or polyalkylene glycol group containing an alkylene group having 2 or 3 carbon atoms; when m is 2 or 3, R? is a divalent or trivalent organic group derived from a diol or triol. The copolymerization reaction is performed using a hydrocarbon-based peroxide or azo compound polymerization initiator.

Abstract: Disclosed is an emulsion formed using, as an emulsifier, 0.01 to 30 parts by weight of a perfluoroalkylethyl phosphonic acid salt represented by the general formula: CnF2n+1CH2CH2P(O)(OM1)(OM2) [III] (M1: a hydrogen atom, ammonium salt, or organic amine salt, M2: an ammonium salt or organic amine salt, n: 1 to 6), based on 100 parts by weight of a perfluoropolyether oil represented by the general formula: RfO(C3F6O)p(C2F4O)q(CF2O)rRf? [I] (Rf and Rf?: C1-C5 perfluoroalkyl groups, p+q+r: 2 to 200) or the general formula: F(CF2CF2CF2O)nCF2CF3 [II] (n: 2 to 100), or a perfluorocarbon compound. In spite of using, as an emulsifier, a compound having a perfluoroalkyl group containing 6 or less carbon atoms, which is said to have low bioaccumulation potential, the emulsion exhibits excellent emulsification stability, and therefore can be effectively used as a surface-treating agent, such as a mold-releasing agent.

Abstract: Provided is a fluorine-containing macroinitiator, particularly a fluorine-containing macroinitiator that enables production of a fluorine-containing block copolymer containing a non-fluorine vinyl-based monomer having a long side chain. The fluorine-containing macroinitiator includes a polymer represented by the following formula (1) and having a number-average molecular weight of 3,000 to 100,000. In the following formula (1), R2, R3 and R4 are each a specific group, and Q is a polymer segment composed of a structural unit represented by the following formula (2). In the following formula (2), R1 is a hydrogen atom or a methyl group, Rf is a fluoroalkyl group having a specific structure, and k is an appropriate integer that is not 0.

Abstract: Fluorine-containing boric acid composite capsule particles comprising a condensate of a fluorine-containing alcohol, a guest compound, and boric acid particles, wherein the fluorine-containing alcohol is represented by the general formula: RF-A-OH wherein RF is: a perfluoroalkyl group having 6 or less carbon atoms, a linear or branched perfluoroalkyl group containing a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, and containing an O, S, or N atom, or a polyfluoroalkyl group in which some of the fluorine atom or atoms of the perfluoroalkyl group are replaced by hydrogen atom or atoms, and which contains a terminal perfluoroalkyl group having 6 or less carbon atoms and a perfluoroalkylene group having 6 or less carbon atoms, wherein the perfluoroalkylene group may contain an O, S, or N atom, and one fluorine atom of the terminal perfluoroalkyl group may be replaced by —(CH2)f0H (wherein f is an integer of 1 to 3); and A is an alky